ChemPal Documentation - v1.15.1
    Preparing search index...

    Class Cactus

    A client for the Cactus Chemical Identifier Resolver API.

    This class provides methods to retrieve various chemical information including names, structures, properties, and identifiers from the NCI Cactus service.

    API Documentation: https://cactus.nci.nih.gov/chemical/structure_documentation

    This service works as a resolver for different chemical structure identifiers and allows one to convert a given structure identifier into another representation or structure identifier. You can either use the web form of the resolver or the following simple URL API scheme:

    http:///chemical/structure/"structure identifier"/"representation"
    

    The service returns the requested new structure representation with a corresponding MIME-Type specification (in most cases MIME-Type: "text/plain"). If a requested URL is not resolvable for the service an HTML 404 status message is returned. In the (unlikely) case of an error, an HTML 500 status message is generated.

    const cactus = new Cactus("aspirin");
    const names = await cactus.getNames();
    console.log(names); // ["aspirin", "acetylsalicylic acid", ...]
    export class Cactus {
    /** Chemical name */
    private name: string;

    /** Whether to enable caching */
    private cacheEnabled: boolean = true;

    /** Base URL */
    private readonly baseURL: string = 'https://cactus.nci.nih.gov/chemical/structure';

    /** Whether to return responses in XML format */
    private formatXML: boolean = false;

    /** Cache */
    private cache?: LRUCache<string, string>;

    /** Static cache shared across all Cactus instances */
    private static globalCache: LRUCache<string, string> = new LRUCache({
    max: 1000,
    ttl: 1000 * 60 * 60, // 1 hour
    });

    /**
    * Creates a new Cactus instance for the specified chemical.
    *
    * @param name - The chemical name, formula, or identifier to query
    * @param formatXML - Whether to return responses in XML format
    * @param cacheOptions - Optional cache configuration
    * @throws Error When no chemical name is provided
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const ethanol = new Cactus("C2H5OH", false, { max: 500, ttl: 1800000 });
    * const caffeine = new Cactus("58-08-2", false, { enabled: false }); // Disable caching
    * ```
    * @source
    */
    constructor(name: string, formatXML: boolean = false, cacheOptions: CactusCacheOptions = {}) {
    if (!name) {
    throw new Error('Chemical name is required');
    }
    this.name = name;
    this.formatXML = formatXML;
    this.cacheEnabled = cacheOptions.enabled !== false; // Default to true

    if (this.cacheEnabled) {
    this.cache = new LRUCache({
    max: cacheOptions.max ?? 100,
    ttl: cacheOptions.ttl ?? 1000 * 60 * 30, // 30 minutes default
    });
    }
    }

    /**
    * Sets the format of the response to XML.
    *
    * @param formatXML - Whether to return responses in XML format
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * aspirin.setFormatXML(true);
    * const names = await aspirin.getNames();
    * // Returns: XML response
    * ```
    * @source
    */
    public setFormatXML(formatXML: boolean): void {
    this.formatXML = formatXML;
    }

    /**
    * Clears the instance cache.
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * await aspirin.getNames(); // This will be cached
    * aspirin.clearCache(); // Clear the cache
    * await aspirin.getNames(); // This will make a new request
    * ```
    * @source
    */
    public clearCache(): void {
    this.cache?.clear();
    }

    /**
    * Clears the global cache shared across all Cactus instances.
    *
    * @example
    * ```typescript
    * const aspirin1 = new Cactus("aspirin");
    * const aspirin2 = new Cactus("aspirin");
    * await aspirin1.getNames(); // Cached globally
    * await aspirin2.getNames(); // Uses cached result
    * Cactus.clearGlobalCache(); // Clear global cache
    * await aspirin2.getNames(); // Makes new request
    * ```
    * @source
    */
    public static clearGlobalCache(): void {
    Cactus.globalCache.clear();
    }

    /**
    * Gets cache statistics for debugging purposes.
    *
    * @returns Object containing cache statistics
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * await aspirin.getNames();
    * const stats = aspirin.getCacheStats();
    * console.log(stats); // { size: 1 }
    * ```
    * @source
    */
    public getCacheStats(): { size: number } {
    if (!this.cache) {
    return {
    size: 0,
    };
    }

    return {
    size: this.cache.size,
    };
    }

    /**
    * Queries the specified endpoint and returns the response text.
    * Uses caching to avoid duplicate requests for the same URL.
    *
    * @param endpoint - The endpoint to query
    * @returns Promise resolving to the response text or undefined if the request fails
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const names = await aspirin.queryEndpoint("names");
    * // Returns: "2-acetyloxybenzoic acid\n2-Acetoxybenzoic acid\n50-78-2\n11126-35-5\n11126-37-7\n..."
    * aspirin.setFormatXML(true);
    * const names = await aspirin.queryEndpoint("names");
    * // Returns:
    * <request string="aspirin" representation="names">
    * <data id="1" resolver="name_by_cir" string_class="chemical name (CIR)" notation="Aspirin">
    * <item id="1" classification="pubchem_iupac_name">2-acetyloxybenzoic acid</item>
    * <item id="2" classification="pubchem_iupac_openeye_name">2-Acetoxybenzoic acid</item>
    * <item id="3" classification="pubchem_generic_registry_name">50-78-2</item>
    * <item id="7" classification="pubchem_generic_registry_name">26914-13-6</item>
    * <item id="8" classification="pubchem_generic_registry_name">98201-60-6</item>
    * <item id="9" classification="pubchem_substance_synonym">NCGC00090977-04</item>
    * <item id="10" classification="pubchem_substance_synonym">KBioSS_002272</item>
    * <item id="11" classification="pubchem_substance_synonym">SBB015069</item>
    * ...
    * </data>
    * </request>
    * ```
    * @source
    */
    private async queryEndpoint(endpoint: CactusEndpoint): Promise<string | Blob> {
    // Encode the identifier so structure inputs (e.g. SMILES, which contain
    // "#", "/", "+") don't break the URL path. The endpoint is a fixed,
    // URL-safe token (it may carry its own query string) and is left as-is.
    let url = `${this.baseURL}/${encodeURIComponent(this.name)}/${endpoint}`;
    if (this.formatXML) url += `/xml`;

    // Check cache first
    if (this.cacheEnabled) {
    const cachedResult = this.cache?.get(url) ?? Cactus.globalCache.get(url);
    if (cachedResult !== undefined) {
    return cachedResult;
    }
    }

    const response = await fetch(url);

    const resp = response.clone();
    const headers = resp.headers;
    const contentType = headers.get('content-type') || 'text/plain';

    if (response.status !== StatusCodes.OK) return '';

    let result: string | Blob | undefined;

    if (contentType.startsWith('image/')) {
    result = await response.blob();
    } else if (contentType.startsWith('text/plain') || contentType.startsWith('text/xml')) {
    result = await response.text();
    }

    // Cache the result. result is narrowed to string | Blob here; the
    // LRUCache is string-typed and in practice only text results reach this
    // path, so the assertion is safe and preserves existing caching behavior.
    if (this.cacheEnabled && result !== undefined) {
    this.cache?.set(url, result as string);
    Cactus.globalCache.set(url, result as string);
    }

    return result ?? '';
    }

    /**
    * Retrieves all known names for the chemical.
    *
    * @returns Promise resolving to an array of chemical names
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const names = await aspirin.getNames();
    * // Returns: [
    * // '2-acetyloxybenzoic acid',
    * // '2-Acetoxybenzoic acid',
    * // '50-78-2',
    * // '11126-35-5',
    * // '11126-37-7',
    * // ...
    * // ]
    * ```
    * @source
    */
    async getNames(): Promise<string[] | undefined> {
    const result = await this.queryEndpoint('names');
    assertIsStringResponse(result);
    const results = result.split('\n').filter((name) => !!name);
    if (results.length === 0) {
    return undefined;
    }
    return results;
    }

    /**
    * Filters the names from output of this.getNames() to those that are most likely to
    * be used in common chemical nomenclature. Parenthetical and bracketed qualifiers are stripped
    * first (e.g. "Aspirin (JP15/USP)" or "Acetylsalicylsaure [German]" become "Aspirin"/
    * "Acetylsalicylsaure"), then names are kept only if they contain alpha characters and spaces
    * (no digits, dashes, etc.), de-duplicated, and ranked.
    *
    * @param limit - The maximum number of names to return (default: 4)
    * @returns Promise resolving to an array of chemical names
    * @remarks This method is not guaranteed to return the most simple names. It is a best effort to filter out
    * names that are not likely to be used in common chemical nomenclature. The results are also not sorted in
    * any meaningful way.
    *
    * For example, when searching other names for Aspirin (e.g. "2-Acetoxybenzenecarboxylic acid"), CACTUS
    * returns the recognizable name only as "Aspirin (JP15/USP)". Stripping the parenthetical qualifier
    * recovers the plain "Aspirin" so it can rank alongside the other simple names.
    *
    * @todo Implement a better way to sort these and return only the values that are most likely to yield search
    * results.
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("2-Acetoxybenzenecarboxylic acid");
    * const simpleNames = await aspirin.getSimpleNames(3);
    * // Returns: ["Adiro", "Aspec", "Aspro"]
    * ```
    * @source
    */
    async getSimpleNames(limit: number = 4): Promise<string[] | undefined> {
    const names = await this.getNames();
    if (!names || names.length === 0) {
    return undefined;
    }
    // Strip parenthetical and bracketed qualifiers (e.g. "Aspirin (JP15/USP)" -> "Aspirin",
    // "Acetylsalicylsaure [German]" -> "Acetylsalicylsaure") before filtering, so an otherwise-
    // simple name isn't discarded just because it carries a trailing tag.
    const cleaned = names.map((name) =>
    name
    .replace(/\([^)]*\)|\[[^\]]*\]/g, '')
    .replace(/\s+/g, ' ')
    .trim(),
    );
    const simpleNames = cleaned.filter((name) => /^([a-zA-Z][a-z\s]*)$/.test(name));
    const uniqueNames = [...new Set(simpleNames)];
    return uniqueNames.length > 0
    ? uniqueNames.sort((a, b) => a.length - b.length).slice(0, limit)
    : undefined;
    }

    /**
    * Retrieves the SMILES notation for the chemical.
    *
    * @returns Promise resolving to the SMILES string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const smiles = await aspirin.getSmiles();
    * // Returns: "CC(=O)Oc1ccccc1C(O)=O"
    * ```
    * @source
    */
    async getSmiles(): Promise<string> {
    const result = await this.queryEndpoint('smiles');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the InChI identifier for the chemical.
    *
    * @returns Promise resolving to the InChI string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const inchi = await aspirin.getInchi();
    * // Returns: "InChI=1/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/f/h11H"
    * ```
    * @source
    */
    async getInchi(): Promise<string> {
    const result = await this.queryEndpoint('inchi');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the InChI Key for the chemical.
    *
    * @returns Promise resolving to the InChI Key string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const inchiKey = await aspirin.getInchiKey();
    * // Returns: "BSYNRYMUTXBXSQ-UHFFFAOYSA-N"
    * ```
    * @source
    */
    async getInchiKey(): Promise<string> {
    const result = await this.queryEndpoint('inchikey');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the FICTS identifier for the chemical.
    *
    * @returns Promise resolving to the FICTS string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const ficts = await aspirin.getFicts();
    * // Returns: "FICTS identifier string"
    * ```
    * @source
    */
    async getFicts(): Promise<string> {
    const result = await this.queryEndpoint('ficts');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the FICUS identifier for the chemical.
    *
    * @returns Promise resolving to the FICUS string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const ficus = await aspirin.getFicus();
    * // Returns: "FICUS identifier string"
    * ```
    * @source
    */
    async getFicus(): Promise<string> {
    const result = await this.queryEndpoint('ficus');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the UUUUU identifier for the chemical.
    *
    * This "uuuuu identifier" is a hashcode representation of a chemical structure that considers the basic molecular
    * connectivity, disregarding features like counterions or stereochemistry.
    *
    * @returns Promise resolving to the UUUUU string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const uuuuu = await aspirin.getUuuuu();
    * // Returns: "UUUUU identifier string"
    * ```
    * @source
    */
    async getUuuuu(): Promise<string> {
    const result = await this.queryEndpoint('uuuuu');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the HASHISY identifier for the chemical.
    *
    * This "hashisy identifier" is a hashcode representation of a chemical structure that considers the basic molecular
    * connectivity, disregarding features like counterions or stereochemistry.
    *
    * @returns Promise resolving to the HASHISY string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const hashisy = await aspirin.getHASHISY();
    * // Returns: "Cactvs HASHISY identifier string"
    * ```
    * @source
    */
    async getHASHISY(): Promise<string> {
    const result = await this.queryEndpoint('hashisy');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves a chemical structure file in the specified format.
    *
    * @param format - The file format (e.g., "sdf", "jme", "mol", "pdb")
    * @param removeHydrogens - Whether to remove hydrogen atoms from the structure
    * @returns Promise resolving to the file content as a string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const sdfFile = await aspirin.getFile("sdf");
    * const molFile = await aspirin.getFile("mol", true); // Remove hydrogens
    * ```
    * @source
    */
    async getFile(format: string, removeHydrogens: boolean = false): Promise<string> {
    let url = `${this.baseURL}/${this.name}/file?format=${format}`;

    if (removeHydrogens) {
    url += `&operator=remove_hydrogens`;
    }

    // Check cache first
    if (this.cacheEnabled) {
    const cachedResult = this.cache?.get(url) ?? Cactus.globalCache.get(url);
    if (cachedResult !== undefined) {
    return cachedResult;
    }
    }

    const response = await fetch(url);

    if (response.status !== StatusCodes.OK) return '';

    const result = await response.text();

    // Cache the result
    if (this.cacheEnabled && result !== undefined) {
    this.cache?.set(url, result);
    Cactus.globalCache.set(url, result);
    }

    return result;
    }

    /**
    * Retrieves the chemical structure in SDF (Structure Data File) format.
    *
    * @returns Promise resolving to the SDF file content
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const sdf = await aspirin.getFileSDF();
    * // Returns SDF format structure data
    * ```
    * @source
    */
    async getFileSDF(): Promise<string> {
    return this.getFile('sdf');
    }

    /**
    * Retrieves the chemical structure in JME (Java Molecular Editor) format.
    *
    * @returns Promise resolving to the JME format string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const jme = await aspirin.getFileJME();
    * // Returns JME format structure data
    * ```
    * @source
    */
    async getFileJME(): Promise<string> {
    return this.getFile('jme');
    }

    /**
    * Retrieves the IUPAC name for the chemical.
    *
    * @returns Promise resolving to the IUPAC name
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const iupacName = await aspirin.getIUPACName();
    * // Returns: "2-acetyloxybenzoic acid"
    * ```
    * @source
    */
    async getIUPACName(): Promise<string | undefined> {
    const result = await this.queryEndpoint('iupac_name');
    assertIsStringResponse(result);
    return result === '' ? undefined : result;
    }

    /**
    * Retrieves the CAS registry number for the chemical.
    *
    * @returns Promise resolving to the CAS number
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const cas = await aspirin.getCAS();
    * // Returns: [
    * // '50-78-2',
    * // '11126-35-5',
    * // '11126-37-7',
    * // '2349-94-2',
    * // '26914-13-6',
    * // '98201-60-6'
    * // ]
    * ```
    * @source
    */
    async getCAS(): Promise<string[]> {
    const result = await this.queryEndpoint('cas');
    assertIsStringResponse(result);
    return result.split('\n');
    }

    /**
    * Retrieves the ChemSpider ID for the chemical.
    *
    * @returns Promise resolving to the ChemSpider ID
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const chemspiderId = await aspirin.getChemspiderID();
    * // Returns: "2157"
    * ```
    * @source
    */
    async getChemspiderID(): Promise<string> {
    const result = await this.queryEndpoint('chemspider_id');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the standardized InChI Key for the chemical.
    *
    * @returns Promise resolving to the standardized InChI Key
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const stdInchiKey = await aspirin.getStdinchiKey();
    * // Returns: "BSYNRYMUTXBXSQ-UHFFFAOYSA-N"
    * ```
    * @source
    */
    async getStdinchiKey(): Promise<string> {
    const result = await this.queryEndpoint('stdinchikey');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the standardized InChI for the chemical.
    *
    * @returns Promise resolving to the standardized InChI
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const stdInchi = await aspirin.getStdinchi();
    * // Returns: "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)"
    * ```
    * @source
    */
    async getStdinchi(): Promise<string> {
    const result = await this.queryEndpoint('stdinchi');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves a chemical structure image.
    *
    * @returns Promise resolving to the image data
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const image = await aspirin.getImage();
    * // Returns image data (typically PNG format)
    * ```
    * @source
    */
    async getImage(): Promise<Blob | undefined> {
    const result = await this.queryEndpoint('image');
    if (result && typeof result === 'object' && result instanceof Blob) {
    return result;
    }
    return undefined;
    }

    /**
    * Retrieves the TWIRL identifier for the chemical.
    *
    * @returns Promise resolving to the TWIRL string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const twirl = await aspirin.getTwirl();
    * // Returns the embedable HTML for a TwirlyMol (3D) model of the chemical
    * ```
    * @source
    */
    async getTwirl(): Promise<string> {
    const result = await this.queryEndpoint('twirl');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the molecular weight of the chemical.
    *
    * @returns Promise resolving to the molecular weight as a string
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const mw = await aspirin.getMW();
    * // Returns: "180.1598"
    * ```
    * @source
    */
    async getMW(): Promise<string> {
    const result = await this.queryEndpoint('mw');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the molecular formula of the chemical.
    *
    * @returns Promise resolving to the molecular formula
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const formula = await aspirin.getFormula();
    * // Returns: "C9H8O4"
    * ```
    * @source
    */
    async getFormula(): Promise<string> {
    const result = await this.queryEndpoint('formula');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of hydrogen bond donors in the chemical.
    *
    * @returns Promise resolving to the hydrogen bond donor count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const hbondDonors = await aspirin.getHbondDonorCount();
    * // Returns: "1"
    * ```
    * @source
    */
    async getHbondDonorCount(): Promise<string> {
    const result = await this.queryEndpoint('h_bond_donor_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of hydrogen bond acceptors in the chemical.
    *
    * @returns Promise resolving to the hydrogen bond acceptor count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const hbondAcceptors = await aspirin.getHbondAcceptorCount();
    * // Returns: "4"
    * ```
    * @source
    */
    async getHbondAcceptorCount(): Promise<string> {
    const result = await this.queryEndpoint('h_bond_acceptor_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of hydrogen bond centers in the chemical.
    *
    * @returns Promise resolving to the hydrogen bond center count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const hbondCenters = await aspirin.getHbondCenterCount();
    * // Returns: "4"
    * ```
    * @source
    */
    async getHbondCenterCount(): Promise<string> {
    const result = await this.queryEndpoint('h_bond_center_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of Lipinski's Rule of Five violations.
    *
    * @returns Promise resolving to the Rule of Five violation count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const ruleOf5Violations = await aspirin.getRuleOf5ViolationCount();
    * // Returns: "0" (aspirin follows all rules)
    * ```
    * @source
    */
    async getRuleOf5ViolationCount(): Promise<string> {
    const result = await this.queryEndpoint('rule_of_5_violation_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of rotatable bonds in the chemical.
    *
    * @returns Promise resolving to the rotatable bond count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const rotors = await aspirin.getRotorCount();
    * // Returns: "3"
    * ```
    * @source
    */
    async getRotorCount(): Promise<string> {
    const result = await this.queryEndpoint('rotor_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the effective number of rotatable bonds in the chemical.
    *
    * @returns Promise resolving to the effective rotatable bond count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const effectiveRotors = await aspirin.getEffectiveRotorCount();
    * // Returns: "3.0"
    * ```
    * @source
    */
    async getEffectiveRotorCount(): Promise<string> {
    const result = await this.queryEndpoint('effective_rotor_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of rings in the chemical structure.
    *
    * @returns Promise resolving to the ring count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const rings = await aspirin.getRingCount();
    * // Returns: "1" (benzene ring)
    * ```
    * @source
    */
    async getRingCount(): Promise<string> {
    const result = await this.queryEndpoint('ring_count');
    assertIsStringResponse(result);
    return result;
    }

    /**
    * Retrieves the number of ring systems in the chemical structure.
    *
    * @returns Promise resolving to the ring system count
    *
    * @example
    * ```typescript
    * const aspirin = new Cactus("aspirin");
    * const ringSystems = await aspirin.getRingsysCount();
    * // Returns: "1" (single ring system)
    * ```
    * @source
    */
    async getRingsysCount(): Promise<string> {
    const result = await this.queryEndpoint('ringsys_count');
    assertIsStringResponse(result);
    return result;
    }
    }
    Index

    Constructors

    • Creates a new Cactus instance for the specified chemical.

      Parameters

      • name: string

        The chemical name, formula, or identifier to query

      • formatXML: boolean = false

        Whether to return responses in XML format

      • cacheOptions: CactusCacheOptions = {}

        Optional cache configuration

      Returns Cactus

      Error When no chemical name is provided

      const aspirin = new Cactus("aspirin");
      const ethanol = new Cactus("C2H5OH", false, { max: 500, ttl: 1800000 });
      const caffeine = new Cactus("58-08-2", false, { enabled: false }); // Disable caching

    Methods

    • Sets the format of the response to XML.

      Parameters

      • formatXML: boolean

        Whether to return responses in XML format

      Returns void

      const aspirin = new Cactus("aspirin");
      aspirin.setFormatXML(true);
      const names = await aspirin.getNames();
      // Returns: XML response
        public setFormatXML(formatXML: boolean): void {
      this.formatXML = formatXML;
      }
    • Clears the instance cache.

      Returns void

      const aspirin = new Cactus("aspirin");
      await aspirin.getNames(); // This will be cached
      aspirin.clearCache(); // Clear the cache
      await aspirin.getNames(); // This will make a new request
        public clearCache(): void {
      this.cache?.clear();
      }
    • Clears the global cache shared across all Cactus instances.

      Returns void

      const aspirin1 = new Cactus("aspirin");
      const aspirin2 = new Cactus("aspirin");
      await aspirin1.getNames(); // Cached globally
      await aspirin2.getNames(); // Uses cached result
      Cactus.clearGlobalCache(); // Clear global cache
      await aspirin2.getNames(); // Makes new request
        public static clearGlobalCache(): void {
      Cactus.globalCache.clear();
      }
    • Gets cache statistics for debugging purposes.

      Returns { size: number }

      Object containing cache statistics

      const aspirin = new Cactus("aspirin");
      await aspirin.getNames();
      const stats = aspirin.getCacheStats();
      console.log(stats); // { size: 1 }
        public getCacheStats(): { size: number } {
      if (!this.cache) {
      return {
      size: 0,
      };
      }

      return {
      size: this.cache.size,
      };
      }
    • Queries the specified endpoint and returns the response text. Uses caching to avoid duplicate requests for the same URL.

      Parameters

      Returns Promise<string | Blob>

      Promise resolving to the response text or undefined if the request fails

      const aspirin = new Cactus("aspirin");
      const names = await aspirin.queryEndpoint("names");
      // Returns: "2-acetyloxybenzoic acid\n2-Acetoxybenzoic acid\n50-78-2\n11126-35-5\n11126-37-7\n..."
      aspirin.setFormatXML(true);
      const names = await aspirin.queryEndpoint("names");
      // Returns:
      <request string="aspirin" representation="names">
      <data id="1" resolver="name_by_cir" string_class="chemical name (CIR)" notation="Aspirin">
      <item id="1" classification="pubchem_iupac_name">2-acetyloxybenzoic acid</item>
      <item id="2" classification="pubchem_iupac_openeye_name">2-Acetoxybenzoic acid</item>
      <item id="3" classification="pubchem_generic_registry_name">50-78-2</item>
      <item id="7" classification="pubchem_generic_registry_name">26914-13-6</item>
      <item id="8" classification="pubchem_generic_registry_name">98201-60-6</item>
      <item id="9" classification="pubchem_substance_synonym">NCGC00090977-04</item>
      <item id="10" classification="pubchem_substance_synonym">KBioSS_002272</item>
      <item id="11" classification="pubchem_substance_synonym">SBB015069</item>
      ...
      </data>
      </request>
        private async queryEndpoint(endpoint: CactusEndpoint): Promise<string | Blob> {
      // Encode the identifier so structure inputs (e.g. SMILES, which contain
      // "#", "/", "+") don't break the URL path. The endpoint is a fixed,
      // URL-safe token (it may carry its own query string) and is left as-is.
      let url = `${this.baseURL}/${encodeURIComponent(this.name)}/${endpoint}`;
      if (this.formatXML) url += `/xml`;

      // Check cache first
      if (this.cacheEnabled) {
      const cachedResult = this.cache?.get(url) ?? Cactus.globalCache.get(url);
      if (cachedResult !== undefined) {
      return cachedResult;
      }
      }

      const response = await fetch(url);

      const resp = response.clone();
      const headers = resp.headers;
      const contentType = headers.get('content-type') || 'text/plain';

      if (response.status !== StatusCodes.OK) return '';

      let result: string | Blob | undefined;

      if (contentType.startsWith('image/')) {
      result = await response.blob();
      } else if (contentType.startsWith('text/plain') || contentType.startsWith('text/xml')) {
      result = await response.text();
      }

      // Cache the result. result is narrowed to string | Blob here; the
      // LRUCache is string-typed and in practice only text results reach this
      // path, so the assertion is safe and preserves existing caching behavior.
      if (this.cacheEnabled && result !== undefined) {
      this.cache?.set(url, result as string);
      Cactus.globalCache.set(url, result as string);
      }

      return result ?? '';
      }
    • Retrieves all known names for the chemical.

      Returns Promise<undefined | string[]>

      Promise resolving to an array of chemical names

      const aspirin = new Cactus("aspirin");
      const names = await aspirin.getNames();
      // Returns: [
      // '2-acetyloxybenzoic acid',
      // '2-Acetoxybenzoic acid',
      // '50-78-2',
      // '11126-35-5',
      // '11126-37-7',
      // ...
      // ]
        async getNames(): Promise<string[] | undefined> {
      const result = await this.queryEndpoint('names');
      assertIsStringResponse(result);
      const results = result.split('\n').filter((name) => !!name);
      if (results.length === 0) {
      return undefined;
      }
      return results;
      }
    • Filters the names from output of this.getNames() to those that are most likely to be used in common chemical nomenclature. Parenthetical and bracketed qualifiers are stripped first (e.g. "Aspirin (JP15/USP)" or "Acetylsalicylsaure [German]" become "Aspirin"/ "Acetylsalicylsaure"), then names are kept only if they contain alpha characters and spaces (no digits, dashes, etc.), de-duplicated, and ranked.

      Parameters

      • limit: number = 4

        The maximum number of names to return (default: 4)

      Returns Promise<undefined | string[]>

      Promise resolving to an array of chemical names

      This method is not guaranteed to return the most simple names. It is a best effort to filter out names that are not likely to be used in common chemical nomenclature. The results are also not sorted in any meaningful way.

      For example, when searching other names for Aspirin (e.g. "2-Acetoxybenzenecarboxylic acid"), CACTUS returns the recognizable name only as "Aspirin (JP15/USP)". Stripping the parenthetical qualifier recovers the plain "Aspirin" so it can rank alongside the other simple names.

      Implement a better way to sort these and return only the values that are most likely to yield search results.

      const aspirin = new Cactus("2-Acetoxybenzenecarboxylic acid");
      const simpleNames = await aspirin.getSimpleNames(3);
      // Returns: ["Adiro", "Aspec", "Aspro"]
        async getSimpleNames(limit: number = 4): Promise<string[] | undefined> {
      const names = await this.getNames();
      if (!names || names.length === 0) {
      return undefined;
      }
      // Strip parenthetical and bracketed qualifiers (e.g. "Aspirin (JP15/USP)" -> "Aspirin",
      // "Acetylsalicylsaure [German]" -> "Acetylsalicylsaure") before filtering, so an otherwise-
      // simple name isn't discarded just because it carries a trailing tag.
      const cleaned = names.map((name) =>
      name
      .replace(/\([^)]*\)|\[[^\]]*\]/g, '')
      .replace(/\s+/g, ' ')
      .trim(),
      );
      const simpleNames = cleaned.filter((name) => /^([a-zA-Z][a-z\s]*)$/.test(name));
      const uniqueNames = [...new Set(simpleNames)];
      return uniqueNames.length > 0
      ? uniqueNames.sort((a, b) => a.length - b.length).slice(0, limit)
      : undefined;
      }
    • Retrieves the SMILES notation for the chemical.

      Returns Promise<string>

      Promise resolving to the SMILES string

      const aspirin = new Cactus("aspirin");
      const smiles = await aspirin.getSmiles();
      // Returns: "CC(=O)Oc1ccccc1C(O)=O"
        async getSmiles(): Promise<string> {
      const result = await this.queryEndpoint('smiles');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the InChI identifier for the chemical.

      Returns Promise<string>

      Promise resolving to the InChI string

      const aspirin = new Cactus("aspirin");
      const inchi = await aspirin.getInchi();
      // Returns: "InChI=1/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/f/h11H"
        async getInchi(): Promise<string> {
      const result = await this.queryEndpoint('inchi');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the InChI Key for the chemical.

      Returns Promise<string>

      Promise resolving to the InChI Key string

      const aspirin = new Cactus("aspirin");
      const inchiKey = await aspirin.getInchiKey();
      // Returns: "BSYNRYMUTXBXSQ-UHFFFAOYSA-N"
        async getInchiKey(): Promise<string> {
      const result = await this.queryEndpoint('inchikey');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the FICTS identifier for the chemical.

      Returns Promise<string>

      Promise resolving to the FICTS string

      const aspirin = new Cactus("aspirin");
      const ficts = await aspirin.getFicts();
      // Returns: "FICTS identifier string"
        async getFicts(): Promise<string> {
      const result = await this.queryEndpoint('ficts');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the FICUS identifier for the chemical.

      Returns Promise<string>

      Promise resolving to the FICUS string

      const aspirin = new Cactus("aspirin");
      const ficus = await aspirin.getFicus();
      // Returns: "FICUS identifier string"
        async getFicus(): Promise<string> {
      const result = await this.queryEndpoint('ficus');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the UUUUU identifier for the chemical.

      This "uuuuu identifier" is a hashcode representation of a chemical structure that considers the basic molecular connectivity, disregarding features like counterions or stereochemistry.

      Returns Promise<string>

      Promise resolving to the UUUUU string

      const aspirin = new Cactus("aspirin");
      const uuuuu = await aspirin.getUuuuu();
      // Returns: "UUUUU identifier string"
        async getUuuuu(): Promise<string> {
      const result = await this.queryEndpoint('uuuuu');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the HASHISY identifier for the chemical.

      This "hashisy identifier" is a hashcode representation of a chemical structure that considers the basic molecular connectivity, disregarding features like counterions or stereochemistry.

      Returns Promise<string>

      Promise resolving to the HASHISY string

      const aspirin = new Cactus("aspirin");
      const hashisy = await aspirin.getHASHISY();
      // Returns: "Cactvs HASHISY identifier string"
        async getHASHISY(): Promise<string> {
      const result = await this.queryEndpoint('hashisy');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves a chemical structure file in the specified format.

      Parameters

      • format: string

        The file format (e.g., "sdf", "jme", "mol", "pdb")

      • removeHydrogens: boolean = false

        Whether to remove hydrogen atoms from the structure

      Returns Promise<string>

      Promise resolving to the file content as a string

      const aspirin = new Cactus("aspirin");
      const sdfFile = await aspirin.getFile("sdf");
      const molFile = await aspirin.getFile("mol", true); // Remove hydrogens
        async getFile(format: string, removeHydrogens: boolean = false): Promise<string> {
      let url = `${this.baseURL}/${this.name}/file?format=${format}`;

      if (removeHydrogens) {
      url += `&operator=remove_hydrogens`;
      }

      // Check cache first
      if (this.cacheEnabled) {
      const cachedResult = this.cache?.get(url) ?? Cactus.globalCache.get(url);
      if (cachedResult !== undefined) {
      return cachedResult;
      }
      }

      const response = await fetch(url);

      if (response.status !== StatusCodes.OK) return '';

      const result = await response.text();

      // Cache the result
      if (this.cacheEnabled && result !== undefined) {
      this.cache?.set(url, result);
      Cactus.globalCache.set(url, result);
      }

      return result;
      }
    • Retrieves the chemical structure in SDF (Structure Data File) format.

      Returns Promise<string>

      Promise resolving to the SDF file content

      const aspirin = new Cactus("aspirin");
      const sdf = await aspirin.getFileSDF();
      // Returns SDF format structure data
        async getFileSDF(): Promise<string> {
      return this.getFile('sdf');
      }
    • Retrieves the chemical structure in JME (Java Molecular Editor) format.

      Returns Promise<string>

      Promise resolving to the JME format string

      const aspirin = new Cactus("aspirin");
      const jme = await aspirin.getFileJME();
      // Returns JME format structure data
        async getFileJME(): Promise<string> {
      return this.getFile('jme');
      }
    • Retrieves the IUPAC name for the chemical.

      Returns Promise<undefined | string>

      Promise resolving to the IUPAC name

      const aspirin = new Cactus("aspirin");
      const iupacName = await aspirin.getIUPACName();
      // Returns: "2-acetyloxybenzoic acid"
        async getIUPACName(): Promise<string | undefined> {
      const result = await this.queryEndpoint('iupac_name');
      assertIsStringResponse(result);
      return result === '' ? undefined : result;
      }
    • Retrieves the CAS registry number for the chemical.

      Returns Promise<string[]>

      Promise resolving to the CAS number

      const aspirin = new Cactus("aspirin");
      const cas = await aspirin.getCAS();
      // Returns: [
      // '50-78-2',
      // '11126-35-5',
      // '11126-37-7',
      // '2349-94-2',
      // '26914-13-6',
      // '98201-60-6'
      // ]
        async getCAS(): Promise<string[]> {
      const result = await this.queryEndpoint('cas');
      assertIsStringResponse(result);
      return result.split('\n');
      }
    • Retrieves the ChemSpider ID for the chemical.

      Returns Promise<string>

      Promise resolving to the ChemSpider ID

      const aspirin = new Cactus("aspirin");
      const chemspiderId = await aspirin.getChemspiderID();
      // Returns: "2157"
        async getChemspiderID(): Promise<string> {
      const result = await this.queryEndpoint('chemspider_id');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the standardized InChI Key for the chemical.

      Returns Promise<string>

      Promise resolving to the standardized InChI Key

      const aspirin = new Cactus("aspirin");
      const stdInchiKey = await aspirin.getStdinchiKey();
      // Returns: "BSYNRYMUTXBXSQ-UHFFFAOYSA-N"
        async getStdinchiKey(): Promise<string> {
      const result = await this.queryEndpoint('stdinchikey');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the standardized InChI for the chemical.

      Returns Promise<string>

      Promise resolving to the standardized InChI

      const aspirin = new Cactus("aspirin");
      const stdInchi = await aspirin.getStdinchi();
      // Returns: "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)"
        async getStdinchi(): Promise<string> {
      const result = await this.queryEndpoint('stdinchi');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves a chemical structure image.

      Returns Promise<undefined | Blob>

      Promise resolving to the image data

      const aspirin = new Cactus("aspirin");
      const image = await aspirin.getImage();
      // Returns image data (typically PNG format)
        async getImage(): Promise<Blob | undefined> {
      const result = await this.queryEndpoint('image');
      if (result && typeof result === 'object' && result instanceof Blob) {
      return result;
      }
      return undefined;
      }
    • Retrieves the TWIRL identifier for the chemical.

      Returns Promise<string>

      Promise resolving to the TWIRL string

      const aspirin = new Cactus("aspirin");
      const twirl = await aspirin.getTwirl();
      // Returns the embedable HTML for a TwirlyMol (3D) model of the chemical
        async getTwirl(): Promise<string> {
      const result = await this.queryEndpoint('twirl');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the molecular weight of the chemical.

      Returns Promise<string>

      Promise resolving to the molecular weight as a string

      const aspirin = new Cactus("aspirin");
      const mw = await aspirin.getMW();
      // Returns: "180.1598"
        async getMW(): Promise<string> {
      const result = await this.queryEndpoint('mw');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the molecular formula of the chemical.

      Returns Promise<string>

      Promise resolving to the molecular formula

      const aspirin = new Cactus("aspirin");
      const formula = await aspirin.getFormula();
      // Returns: "C9H8O4"
        async getFormula(): Promise<string> {
      const result = await this.queryEndpoint('formula');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of hydrogen bond donors in the chemical.

      Returns Promise<string>

      Promise resolving to the hydrogen bond donor count

      const aspirin = new Cactus("aspirin");
      const hbondDonors = await aspirin.getHbondDonorCount();
      // Returns: "1"
        async getHbondDonorCount(): Promise<string> {
      const result = await this.queryEndpoint('h_bond_donor_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of hydrogen bond acceptors in the chemical.

      Returns Promise<string>

      Promise resolving to the hydrogen bond acceptor count

      const aspirin = new Cactus("aspirin");
      const hbondAcceptors = await aspirin.getHbondAcceptorCount();
      // Returns: "4"
        async getHbondAcceptorCount(): Promise<string> {
      const result = await this.queryEndpoint('h_bond_acceptor_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of hydrogen bond centers in the chemical.

      Returns Promise<string>

      Promise resolving to the hydrogen bond center count

      const aspirin = new Cactus("aspirin");
      const hbondCenters = await aspirin.getHbondCenterCount();
      // Returns: "4"
        async getHbondCenterCount(): Promise<string> {
      const result = await this.queryEndpoint('h_bond_center_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of Lipinski's Rule of Five violations.

      Returns Promise<string>

      Promise resolving to the Rule of Five violation count

      const aspirin = new Cactus("aspirin");
      const ruleOf5Violations = await aspirin.getRuleOf5ViolationCount();
      // Returns: "0" (aspirin follows all rules)
        async getRuleOf5ViolationCount(): Promise<string> {
      const result = await this.queryEndpoint('rule_of_5_violation_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of rotatable bonds in the chemical.

      Returns Promise<string>

      Promise resolving to the rotatable bond count

      const aspirin = new Cactus("aspirin");
      const rotors = await aspirin.getRotorCount();
      // Returns: "3"
        async getRotorCount(): Promise<string> {
      const result = await this.queryEndpoint('rotor_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the effective number of rotatable bonds in the chemical.

      Returns Promise<string>

      Promise resolving to the effective rotatable bond count

      const aspirin = new Cactus("aspirin");
      const effectiveRotors = await aspirin.getEffectiveRotorCount();
      // Returns: "3.0"
        async getEffectiveRotorCount(): Promise<string> {
      const result = await this.queryEndpoint('effective_rotor_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of rings in the chemical structure.

      Returns Promise<string>

      Promise resolving to the ring count

      const aspirin = new Cactus("aspirin");
      const rings = await aspirin.getRingCount();
      // Returns: "1" (benzene ring)
        async getRingCount(): Promise<string> {
      const result = await this.queryEndpoint('ring_count');
      assertIsStringResponse(result);
      return result;
      }
    • Retrieves the number of ring systems in the chemical structure.

      Returns Promise<string>

      Promise resolving to the ring system count

      const aspirin = new Cactus("aspirin");
      const ringSystems = await aspirin.getRingsysCount();
      // Returns: "1" (single ring system)
        async getRingsysCount(): Promise<string> {
      const result = await this.queryEndpoint('ringsys_count');
      assertIsStringResponse(result);
      return result;
      }

    Properties

    name: string

    Chemical name

    cacheEnabled: boolean = true

    Whether to enable caching

    baseURL: string = 'https://cactus.nci.nih.gov/chemical/structure'

    Base URL

    formatXML: boolean = false

    Whether to return responses in XML format

    cache?: LRUCache<string, string, unknown>

    Cache

    globalCache: LRUCache<string, string> = ...

    Static cache shared across all Cactus instances